C11H26N2O2S — CID 103829022
N-(2-amino-3-methylbutyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 103829022) has the molecular formula C11H26N2O2S and a molecular weight of 250.41 g/mol. Its IUPAC name is N-(2-amino-3-methylbutyl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-(2-amino-3-methylbutyl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103829022 |
| Molecular Formula | C11H26N2O2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | N-(2-amino-3-methylbutyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CC(C)C(N)CNS(=O)(=O)CCC(C)(C)C |
| InChI | InChI=1S/C11H26N2O2S/c1-9(2)10(12)8-13-16(14,15)7-6-11(3,4)5/h9-10,13H,6-8,12H2,1-5H3 |
| InChIKey | IXBAEVFIFGHGPU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |