C11H25NO3S — CID 71848189
N-(3-hydroxypentyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 71848189) has the molecular formula C11H25NO3S and a molecular weight of 251.39 g/mol. Its IUPAC name is N-(3-hydroxypentyl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-(3-hydroxypentyl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 71848189 |
| Molecular Formula | C11H25NO3S |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | N-(3-hydroxypentyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CCC(O)CCNS(=O)(=O)CCC(C)(C)C |
| InChI | InChI=1S/C11H25NO3S/c1-5-10(13)6-8-12-16(14,15)9-7-11(2,3)4/h10,12-13H,5-9H2,1-4H3 |
| InChIKey | XFZFBXKTVITJEN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |