C13H30N2O2S — CID 106286721
N-(2-amino-3-ethylpentyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 106286721) has the molecular formula C13H30N2O2S and a molecular weight of 278.46 g/mol. Its IUPAC name is N-(2-amino-3-ethylpentyl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-(2-amino-3-ethylpentyl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 106286721 |
| Molecular Formula | C13H30N2O2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-(2-amino-3-ethylpentyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CCC(CC)C(N)CNS(=O)(=O)CCC(C)(C)C |
| InChI | InChI=1S/C13H30N2O2S/c1-6-11(7-2)12(14)10-15-18(16,17)9-8-13(3,4)5/h11-12,15H,6-10,14H2,1-5H3 |
| InChIKey | DCPSGOSCHGTYKY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |