C8H18N2O3S — CID 103521045
2-(3,3-dimethylbutylsulfonylamino)acetamide (PubChem CID 103521045) has the molecular formula C8H18N2O3S and a molecular weight of 222.31 g/mol. Its IUPAC name is 2-(3,3-dimethylbutylsulfonylamino)acetamide.
| Compound Name | 2-(3,3-dimethylbutylsulfonylamino)acetamide |
|---|---|
| PubChem CID | 103521045 |
| Molecular Formula | C8H18N2O3S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-(3,3-dimethylbutylsulfonylamino)acetamide |
| SMILES | CC(C)(C)CCS(=O)(=O)NCC(N)=O |
| InChI | InChI=1S/C8H18N2O3S/c1-8(2,3)4-5-14(12,13)10-6-7(9)11/h10H,4-6H2,1-3H3,(H2,9,11) |
| InChIKey | FCNNYNJJDCHPRY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |