C7H17NO4S2 — CID 64591010
N-tert-butyl-2-methylsulfonylethanesulfonamide (PubChem CID 64591010) has the molecular formula C7H17NO4S2 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-tert-butyl-2-methylsulfonylethanesulfonamide.
| Compound Name | N-tert-butyl-2-methylsulfonylethanesulfonamide |
|---|---|
| PubChem CID | 64591010 |
| Molecular Formula | C7H17NO4S2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | N-tert-butyl-2-methylsulfonylethanesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)CCS(C)(=O)=O |
| InChI | InChI=1S/C7H17NO4S2/c1-7(2,3)8-14(11,12)6-5-13(4,9)10/h8H,5-6H2,1-4H3 |
| InChIKey | ZXZZWEJCMWDNLU-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |