C10H25NO2S — CID 161299007
N-tert-butylmethanesulfonamide;2,2-dimethylpropane (PubChem CID 161299007) has the molecular formula C10H25NO2S and a molecular weight of 223.38 g/mol. Its IUPAC name is N-tert-butylmethanesulfonamide;2,2-dimethylpropane.
| Compound Name | N-tert-butylmethanesulfonamide;2,2-dimethylpropane |
|---|---|
| PubChem CID | 161299007 |
| Molecular Formula | C10H25NO2S |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | N-tert-butylmethanesulfonamide;2,2-dimethylpropane |
| SMILES | CC(C)(C)C.CC(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C5H13NO2S.C5H12/c1-5(2,3)6-9(4,7)8;1-5(2,3)4/h6H,1-4H3;1-4H3 |
| InChIKey | VHIWBIMZZMIBSR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |