About N-[4-(dimethylamino)-2,4-dimethylpentan-2-yl]methanesulfonamide
N-[4-(dimethylamino)-2,4-dimethylpentan-2-yl]methanesulfonamide (PubChem CID 89331793) has the molecular formula C10H24N2O2S
and a molecular weight of 236.38 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2,4-dimethylpentan-2-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[4-(dimethylamino)-2,4-dimethylpentan-2-yl]methanesulfonamide |
| PubChem CID | 89331793 |
| Molecular Formula | C10H24N2O2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | N-[4-(dimethylamino)-2,4-dimethylpentan-2-yl]methanesulfonamide |
| SMILES | CN(C)C(C)(C)CC(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C10H24N2O2S/c1-9(2,11-15(7,13)14)8-10(3,4)12(5)6/h11H,8H2,1-7H3 |
| InChIKey | KTVQBPLTONEMFS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-(dimethylamino)-2,4-dimethylpentan-2-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(dimethylamino)-2,4-dimethylpentan-2-yl]methanesulfonamide?
The IUPAC name of N-[4-(dimethylamino)-2,4-dimethylpentan-2-yl]methanesulfonamide (CID 89331793) is N-[4-(dimethylamino)-2,4-dimethylpentan-2-yl]methanesulfonamide.
What is the SMILES notation for N-[4-(dimethylamino)-2,4-dimethylpentan-2-yl]methanesulfonamide?
The canonical SMILES for N-[4-(dimethylamino)-2,4-dimethylpentan-2-yl]methanesulfonamide is CN(C)C(C)(C)CC(C)(C)NS(C)(=O)=O.
What is the InChIKey of N-[4-(dimethylamino)-2,4-dimethylpentan-2-yl]methanesulfonamide?
The InChIKey is KTVQBPLTONEMFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2O2S/c1-9(2,11-15(7,13)14)8-10(3,4)12(5)6/h11H,8H2,1-7H3.
What are the key properties of N-[4-(dimethylamino)-2,4-dimethylpentan-2-yl]methanesulfonamide?
N-[4-(dimethylamino)-2,4-dimethylpentan-2-yl]methanesulfonamide has a molecular weight of 236.38 g/mol, XLogP of 1.04, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(dimethylamino)-2,4-dimethylpentan-2-yl]methanesulfonamide is sourced from PubChem (CID 89331793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).