C9H22N2O4S2 — CID 64630784
N-[2-methyl-1-(1-methylsulfonylpropan-2-ylamino)propan-2-yl]methanesulfonamide (PubChem CID 64630784) has the molecular formula C9H22N2O4S2 and a molecular weight of 286.42 g/mol. Its IUPAC name is N-[2-methyl-1-(1-methylsulfonylpropan-2-ylamino)propan-2-yl]methanesulfonamide.
| Compound Name | N-[2-methyl-1-(1-methylsulfonylpropan-2-ylamino)propan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 64630784 |
| Molecular Formula | C9H22N2O4S2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-[2-methyl-1-(1-methylsulfonylpropan-2-ylamino)propan-2-yl]methanesulfonamide |
| SMILES | CC(CS(C)(=O)=O)NCC(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C9H22N2O4S2/c1-8(6-16(4,12)13)10-7-9(2,3)11-17(5,14)15/h8,10-11H,6-7H2,1-5H3 |
| InChIKey | UETBJQXAJLOXDH-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |