C11H25NO2S2 — CID 115901167
2-ethyl-2-methylsulfanyl-N-(1-methylsulfonylpropan-2-yl)butan-1-amine (PubChem CID 115901167) has the molecular formula C11H25NO2S2 and a molecular weight of 267.46 g/mol. Its IUPAC name is 2-ethyl-2-methylsulfanyl-N-(1-methylsulfonylpropan-2-yl)butan-1-amine.
| Compound Name | 2-ethyl-2-methylsulfanyl-N-(1-methylsulfonylpropan-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 115901167 |
| Molecular Formula | C11H25NO2S2 |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-ethyl-2-methylsulfanyl-N-(1-methylsulfonylpropan-2-yl)butan-1-amine |
| SMILES | CCC(CC)(CNC(C)CS(C)(=O)=O)SC |
| InChI | InChI=1S/C11H25NO2S2/c1-6-11(7-2,15-4)9-12-10(3)8-16(5,13)14/h10,12H,6-9H2,1-5H3 |
| InChIKey | RRARECSBCZROJD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |