C11H26N2O2S2 — CID 106092341
N-(2-ethyl-2-methylsulfanylbutyl)-1-(methylamino)propane-2-sulfonamide (PubChem CID 106092341) has the molecular formula C11H26N2O2S2 and a molecular weight of 282.47 g/mol. Its IUPAC name is N-(2-ethyl-2-methylsulfanylbutyl)-1-(methylamino)propane-2-sulfonamide.
| Compound Name | N-(2-ethyl-2-methylsulfanylbutyl)-1-(methylamino)propane-2-sulfonamide |
|---|---|
| PubChem CID | 106092341 |
| Molecular Formula | C11H26N2O2S2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-(2-ethyl-2-methylsulfanylbutyl)-1-(methylamino)propane-2-sulfonamide |
| SMILES | CCC(CC)(CNS(=O)(=O)C(C)CNC)SC |
| InChI | InChI=1S/C11H26N2O2S2/c1-6-11(7-2,16-5)9-13-17(14,15)10(3)8-12-4/h10,12-13H,6-9H2,1-5H3 |
| InChIKey | VVUMDVLNSYJDJH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |