C9H19F3N2O2S — CID 113328190
1-(methylamino)-N-(5,5,5-trifluoropentyl)propane-2-sulfonamide (PubChem CID 113328190) has the molecular formula C9H19F3N2O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is 1-(methylamino)-N-(5,5,5-trifluoropentyl)propane-2-sulfonamide.
| Compound Name | 1-(methylamino)-N-(5,5,5-trifluoropentyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 113328190 |
| Molecular Formula | C9H19F3N2O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-(methylamino)-N-(5,5,5-trifluoropentyl)propane-2-sulfonamide |
| SMILES | CNCC(C)S(=O)(=O)NCCCCC(F)(F)F |
| InChI | InChI=1S/C9H19F3N2O2S/c1-8(7-13-2)17(15,16)14-6-4-3-5-9(10,11)12/h8,13-14H,3-7H2,1-2H3 |
| InChIKey | IESDZKMMQHLADT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|