C12H24F3N3O2S — CID 115522886
4-(methylaminomethyl)-N-(5,5,5-trifluoropentyl)piperidine-1-sulfonamide (PubChem CID 115522886) has the molecular formula C12H24F3N3O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is 4-(methylaminomethyl)-N-(5,5,5-trifluoropentyl)piperidine-1-sulfonamide.
| Compound Name | 4-(methylaminomethyl)-N-(5,5,5-trifluoropentyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 115522886 |
| Molecular Formula | C12H24F3N3O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 4-(methylaminomethyl)-N-(5,5,5-trifluoropentyl)piperidine-1-sulfonamide |
| SMILES | CNCC1CCN(S(=O)(=O)NCCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H24F3N3O2S/c1-16-10-11-4-8-18(9-5-11)21(19,20)17-7-3-2-6-12(13,14)15/h11,16-17H,2-10H2,1H3 |
| InChIKey | HQYHILPRXOECJP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|