C10H19F3N2O3S — CID 115522645
4-(hydroxymethyl)-N-(4,4,4-trifluorobutyl)piperidine-1-sulfonamide (PubChem CID 115522645) has the molecular formula C10H19F3N2O3S and a molecular weight of 304.33 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N-(4,4,4-trifluorobutyl)piperidine-1-sulfonamide.
| Compound Name | 4-(hydroxymethyl)-N-(4,4,4-trifluorobutyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 115522645 |
| Molecular Formula | C10H19F3N2O3S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-(hydroxymethyl)-N-(4,4,4-trifluorobutyl)piperidine-1-sulfonamide |
| SMILES | O=S(=O)(NCCCC(F)(F)F)N1CCC(CO)CC1 |
| InChI | InChI=1S/C10H19F3N2O3S/c11-10(12,13)4-1-5-14-19(17,18)15-6-2-9(8-16)3-7-15/h9,14,16H,1-8H2 |
| InChIKey | UCJQWYPHKKHMGV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|