C9H17F3N2O3S2 — CID 106433638
4-(hydroxymethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-sulfonamide (PubChem CID 106433638) has the molecular formula C9H17F3N2O3S2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-sulfonamide.
| Compound Name | 4-(hydroxymethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 106433638 |
| Molecular Formula | C9H17F3N2O3S2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 4-(hydroxymethyl)-N-[2-(trifluoromethylsulfanyl)ethyl]piperidine-1-sulfonamide |
| SMILES | O=S(=O)(NCCSC(F)(F)F)N1CCC(CO)CC1 |
| InChI | InChI=1S/C9H17F3N2O3S2/c10-9(11,12)18-6-3-13-19(16,17)14-4-1-8(7-15)2-5-14/h8,13,15H,1-7H2 |
| InChIKey | DRENYJQLWCVYNH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|