C10H18F3NO3S — CID 83059984
[1-(4,4,4-trifluorobutylsulfonyl)piperidin-3-yl]methanol (PubChem CID 83059984) has the molecular formula C10H18F3NO3S and a molecular weight of 289.32 g/mol. Its IUPAC name is [1-(4,4,4-trifluorobutylsulfonyl)piperidin-3-yl]methanol.
| Compound Name | [1-(4,4,4-trifluorobutylsulfonyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 83059984 |
| Molecular Formula | C10H18F3NO3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [1-(4,4,4-trifluorobutylsulfonyl)piperidin-3-yl]methanol |
| SMILES | O=S(=O)(CCCC(F)(F)F)N1CCCC(CO)C1 |
| InChI | InChI=1S/C10H18F3NO3S/c11-10(12,13)4-2-6-18(16,17)14-5-1-3-9(7-14)8-15/h9,15H,1-8H2 |
| InChIKey | XIYHYFSEHKRHHN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |