C9H20FN3O4S2 — CID 154789563
1-(3-fluoropropylsulfonyl)-3-[(sulfamoylamino)methyl]piperidine (PubChem CID 154789563) has the molecular formula C9H20FN3O4S2 and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-(3-fluoropropylsulfonyl)-3-[(sulfamoylamino)methyl]piperidine.
| Compound Name | 1-(3-fluoropropylsulfonyl)-3-[(sulfamoylamino)methyl]piperidine |
|---|---|
| PubChem CID | 154789563 |
| Molecular Formula | C9H20FN3O4S2 |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 1-(3-fluoropropylsulfonyl)-3-[(sulfamoylamino)methyl]piperidine |
| SMILES | NS(=O)(=O)NCC1CCCN(S(=O)(=O)CCCF)C1 |
| InChI | InChI=1S/C9H20FN3O4S2/c10-4-2-6-18(14,15)13-5-1-3-9(8-13)7-12-19(11,16)17/h9,12H,1-8H2,(H2,11,16,17) |
| InChIKey | FPKAFSQNLDXSDX-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |