C12H25N3O4S2 — CID 61132450
1-cyclohexylsulfonyl-3-[(sulfamoylamino)methyl]piperidine (PubChem CID 61132450) has the molecular formula C12H25N3O4S2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 1-cyclohexylsulfonyl-3-[(sulfamoylamino)methyl]piperidine.
| Compound Name | 1-cyclohexylsulfonyl-3-[(sulfamoylamino)methyl]piperidine |
|---|---|
| PubChem CID | 61132450 |
| Molecular Formula | C12H25N3O4S2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-cyclohexylsulfonyl-3-[(sulfamoylamino)methyl]piperidine |
| SMILES | NS(=O)(=O)NCC1CCCN(S(=O)(=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C12H25N3O4S2/c13-21(18,19)14-9-11-5-4-8-15(10-11)20(16,17)12-6-2-1-3-7-12/h11-12,14H,1-10H2,(H2,13,18,19) |
| InChIKey | ISMHDNZNZZJESE-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |