C10H23N3O5S2 — CID 63246538
1-(2-ethoxyethylsulfonyl)-3-[(sulfamoylamino)methyl]piperidine (PubChem CID 63246538) has the molecular formula C10H23N3O5S2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 1-(2-ethoxyethylsulfonyl)-3-[(sulfamoylamino)methyl]piperidine.
| Compound Name | 1-(2-ethoxyethylsulfonyl)-3-[(sulfamoylamino)methyl]piperidine |
|---|---|
| PubChem CID | 63246538 |
| Molecular Formula | C10H23N3O5S2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 1-(2-ethoxyethylsulfonyl)-3-[(sulfamoylamino)methyl]piperidine |
| SMILES | CCOCCS(=O)(=O)N1CCCC(CNS(N)(=O)=O)C1 |
| InChI | InChI=1S/C10H23N3O5S2/c1-2-18-6-7-19(14,15)13-5-3-4-10(9-13)8-12-20(11,16)17/h10,12H,2-9H2,1H3,(H2,11,16,17) |
| InChIKey | WRGWEARLABDFMZ-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|