C11H23N3O5S2 — CID 62048466
1-(oxan-4-ylsulfonyl)-3-[(sulfamoylamino)methyl]piperidine (PubChem CID 62048466) has the molecular formula C11H23N3O5S2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 1-(oxan-4-ylsulfonyl)-3-[(sulfamoylamino)methyl]piperidine.
| Compound Name | 1-(oxan-4-ylsulfonyl)-3-[(sulfamoylamino)methyl]piperidine |
|---|---|
| PubChem CID | 62048466 |
| Molecular Formula | C11H23N3O5S2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 1-(oxan-4-ylsulfonyl)-3-[(sulfamoylamino)methyl]piperidine |
| SMILES | NS(=O)(=O)NCC1CCCN(S(=O)(=O)C2CCOCC2)C1 |
| InChI | InChI=1S/C11H23N3O5S2/c12-21(17,18)13-8-10-2-1-5-14(9-10)20(15,16)11-3-6-19-7-4-11/h10-11,13H,1-9H2,(H2,12,17,18) |
| InChIKey | DNYYYZVKHGMMRC-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |