C7H13F3N2O2S — CID 63263924
N-methyl-1-[1-(trifluoromethylsulfonyl)pyrrolidin-3-yl]methanamine (PubChem CID 63263924) has the molecular formula C7H13F3N2O2S and a molecular weight of 246.25 g/mol. Its IUPAC name is N-methyl-1-[1-(trifluoromethylsulfonyl)pyrrolidin-3-yl]methanamine.
| Compound Name | N-methyl-1-[1-(trifluoromethylsulfonyl)pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 63263924 |
| Molecular Formula | C7H13F3N2O2S |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | N-methyl-1-[1-(trifluoromethylsulfonyl)pyrrolidin-3-yl]methanamine |
| SMILES | CNCC1CCN(S(=O)(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C7H13F3N2O2S/c1-11-4-6-2-3-12(5-6)15(13,14)7(8,9)10/h6,11H,2-5H2,1H3 |
| InChIKey | WSILKEKUQOHWDF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |