C10H20F3NO2S — CID 113350885
N-(1-ethylsulfonylpropan-2-yl)-5,5,5-trifluoropentan-1-amine (PubChem CID 113350885) has the molecular formula C10H20F3NO2S and a molecular weight of 275.34 g/mol. Its IUPAC name is N-(1-ethylsulfonylpropan-2-yl)-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-(1-ethylsulfonylpropan-2-yl)-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 113350885 |
| Molecular Formula | C10H20F3NO2S |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-(1-ethylsulfonylpropan-2-yl)-5,5,5-trifluoropentan-1-amine |
| SMILES | CCS(=O)(=O)CC(C)NCCCCC(F)(F)F |
| InChI | InChI=1S/C10H20F3NO2S/c1-3-17(15,16)8-9(2)14-7-5-4-6-10(11,12)13/h9,14H,3-8H2,1-2H3 |
| InChIKey | OPCUSIAEBDSJGI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|