C7H17ClN2O4S2 — CID 107651990
2-chloro-N-[2-(methanesulfonamido)-2-methylpropyl]ethanesulfonamide (PubChem CID 107651990) has the molecular formula C7H17ClN2O4S2 and a molecular weight of 292.81 g/mol. Its IUPAC name is 2-chloro-N-[2-(methanesulfonamido)-2-methylpropyl]ethanesulfonamide.
| Compound Name | 2-chloro-N-[2-(methanesulfonamido)-2-methylpropyl]ethanesulfonamide |
|---|---|
| PubChem CID | 107651990 |
| Molecular Formula | C7H17ClN2O4S2 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2-chloro-N-[2-(methanesulfonamido)-2-methylpropyl]ethanesulfonamide |
| SMILES | CC(C)(CNS(=O)(=O)CCCl)NS(C)(=O)=O |
| InChI | InChI=1S/C7H17ClN2O4S2/c1-7(2,10-15(3,11)12)6-9-16(13,14)5-4-8/h9-10H,4-6H2,1-3H3 |
| InChIKey | DOMWBGJOTPBKFA-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|