C8H15F2NO2S — CID 130209119
N-tert-butyl-3,3-difluorocyclobutane-1-sulfonamide (PubChem CID 130209119) has the molecular formula C8H15F2NO2S and a molecular weight of 227.28 g/mol. Its IUPAC name is N-tert-butyl-3,3-difluorocyclobutane-1-sulfonamide.
| Compound Name | N-tert-butyl-3,3-difluorocyclobutane-1-sulfonamide |
|---|---|
| PubChem CID | 130209119 |
| Molecular Formula | C8H15F2NO2S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | N-tert-butyl-3,3-difluorocyclobutane-1-sulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)C1CC(F)(F)C1 |
| InChI | InChI=1S/C8H15F2NO2S/c1-7(2,3)11-14(12,13)6-4-8(9,10)5-6/h6,11H,4-5H2,1-3H3 |
| InChIKey | ALXRARGFMAGWQZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |