C7H14F3NO2S — CID 146411779
N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide (PubChem CID 146411779) has the molecular formula C7H14F3NO2S and a molecular weight of 233.25 g/mol. Its IUPAC name is N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide.
| Compound Name | N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 146411779 |
| Molecular Formula | C7H14F3NO2S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C7H14F3NO2S/c1-6(2,3)11-14(12,13)5-4-7(8,9)10/h11H,4-5H2,1-3H3 |
| InChIKey | HCMYDHWRTOJVKU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |