About N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide
N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide (PubChem CID 146411779) has the molecular formula C7H14F3NO2S
and a molecular weight of 233.25 g/mol. Its IUPAC name is N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide.
Molecular Properties
| Compound Name | N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide |
| PubChem CID | 146411779 |
| Molecular Formula | C7H14F3NO2S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C7H14F3NO2S/c1-6(2,3)11-14(12,13)5-4-7(8,9)10/h11H,4-5H2,1-3H3 |
| InChIKey | HCMYDHWRTOJVKU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide?
The IUPAC name of N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide (CID 146411779) is N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide.
What is the SMILES notation for N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide?
The canonical SMILES for N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide is CC(C)(C)NS(=O)(=O)CCC(F)(F)F.
What is the InChIKey of N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide?
The InChIKey is HCMYDHWRTOJVKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F3NO2S/c1-6(2,3)11-14(12,13)5-4-7(8,9)10/h11H,4-5H2,1-3H3.
What are the key properties of N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide?
N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide has a molecular weight of 233.25 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3,3,3-trifluoropropane-1-sulfonamide is sourced from PubChem (CID 146411779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).