C5H10F3NO2S — CID 54432834
N-tert-butyl-1,1,1-trifluoromethanesulfonamide (PubChem CID 54432834) has the molecular formula C5H10F3NO2S and a molecular weight of 205.20 g/mol. Its IUPAC name is N-tert-butyl-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-tert-butyl-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 54432834 |
| Molecular Formula | C5H10F3NO2S |
| Molecular Weight | 205.20 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | N-tert-butyl-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H10F3NO2S/c1-4(2,3)9-12(10,11)5(6,7)8/h9H,1-3H3 |
| InChIKey | NZYBCWVMVUUMRT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | 243 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |