C7H17F3N2O2S — CID 87657307
2,3-dimethylbutan-2-amine;trifluoromethanesulfonamide (PubChem CID 87657307) has the molecular formula C7H17F3N2O2S and a molecular weight of 250.29 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-amine;trifluoromethanesulfonamide.
| Compound Name | 2,3-dimethylbutan-2-amine;trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 87657307 |
| Molecular Formula | C7H17F3N2O2S |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2,3-dimethylbutan-2-amine;trifluoromethanesulfonamide |
| SMILES | CC(C)C(C)(C)N.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C6H15N.CH2F3NO2S/c1-5(2)6(3,4)7;2-1(3,4)8(5,6)7/h5H,7H2,1-4H3;(H2,5,6,7) |
| InChIKey | ZTTZRTLDEBGAKQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |