C5H11F3N2O3S2 — CID 167420852
N-tert-butylsulfinamoyl-1,1,1-trifluoromethanesulfonamide (PubChem CID 167420852) has the molecular formula C5H11F3N2O3S2 and a molecular weight of 268.28 g/mol. Its IUPAC name is N-tert-butylsulfinamoyl-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-tert-butylsulfinamoyl-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 167420852 |
| Molecular Formula | C5H11F3N2O3S2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | N-tert-butylsulfinamoyl-1,1,1-trifluoromethanesulfonamide |
| SMILES | CC(C)(C)NS(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H11F3N2O3S2/c1-4(2,3)9-14(11)10-15(12,13)5(6,7)8/h9-10H,1-3H3 |
| InChIKey | KZSNPCXFAVAEDK-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |