C7H12F6N2O2S2 — CID 126608056
N-(3-aminopentan-3-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfanyl)methanesulfonamide (PubChem CID 126608056) has the molecular formula C7H12F6N2O2S2 and a molecular weight of 334.31 g/mol. Its IUPAC name is N-(3-aminopentan-3-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfanyl)methanesulfonamide.
| Compound Name | N-(3-aminopentan-3-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfanyl)methanesulfonamide |
|---|---|
| PubChem CID | 126608056 |
| Molecular Formula | C7H12F6N2O2S2 |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | N-(3-aminopentan-3-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfanyl)methanesulfonamide |
| SMILES | CCC(N)(CC)N(SC(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H12F6N2O2S2/c1-3-5(14,4-2)15(18-6(8,9)10)19(16,17)7(11,12)13/h3-4,14H2,1-2H3 |
| InChIKey | OKEREPHDZJTARH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|