C6H10F6N2O4S2 — CID 126608055
N-(2-aminobutan-2-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 126608055) has the molecular formula C6H10F6N2O4S2 and a molecular weight of 352.28 g/mol. Its IUPAC name is N-(2-aminobutan-2-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | N-(2-aminobutan-2-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 126608055 |
| Molecular Formula | C6H10F6N2O4S2 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | N-(2-aminobutan-2-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CCC(C)(N)N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C6H10F6N2O4S2/c1-3-4(2,13)14(19(15,16)5(7,8)9)20(17,18)6(10,11)12/h3,13H2,1-2H3 |
| InChIKey | HYLDSUMGNCOIAQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|