C8H22N2O3S — CID 134113851
tert-butylazanium;N-tert-butylsulfamate (PubChem CID 134113851) has the molecular formula C8H22N2O3S and a molecular weight of 226.34 g/mol. Its IUPAC name is tert-butylazanium;N-tert-butylsulfamate.
| Compound Name | tert-butylazanium;N-tert-butylsulfamate |
|---|---|
| PubChem CID | 134113851 |
| Molecular Formula | C8H22N2O3S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | tert-butylazanium;N-tert-butylsulfamate |
| SMILES | CC(C)(C)NS(=O)(=O)[O-].CC(C)(C)[NH3+] |
| InChI | InChI=1S/C4H11NO3S.C4H11N/c1-4(2,3)5-9(6,7)8;1-4(2,3)5/h5H,1-3H3,(H,6,7,8);5H2,1-3H3 |
| InChIKey | IJAMEOYKRMYIDG-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|