C9H21O4PS-2 — CID 23136681
2,2,4,4-tetramethylpentan-3-ylphosphane sulfate (PubChem CID 23136681) has the molecular formula C9H21O4PS-2 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2,2,4,4-tetramethylpentan-3-ylphosphane sulfate.
| Compound Name | 2,2,4,4-tetramethylpentan-3-ylphosphane sulfate |
|---|---|
| PubChem CID | 23136681 |
| Molecular Formula | C9H21O4PS-2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2,2,4,4-tetramethylpentan-3-ylphosphane sulfate |
| SMILES | CC(C)(C)C(P)C(C)(C)C.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C9H21P.H2O4S/c1-8(2,3)7(10)9(4,5)6;1-5(2,3)4/h7H,10H2,1-6H3;(H2,1,2,3,4)/p-2 |
| InChIKey | XKPDRJAVBXURCG-UHFFFAOYSA-L |
| XLogP | 1.98 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|