C5H11O4S- — CID 5063691
1-hydroxy-2,2-dimethylpropane-1-sulfonate (PubChem CID 5063691) has the molecular formula C5H11O4S- and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-hydroxy-2,2-dimethylpropane-1-sulfonate.
| Compound Name | 1-hydroxy-2,2-dimethylpropane-1-sulfonate |
|---|---|
| PubChem CID | 5063691 |
| Molecular Formula | C5H11O4S- |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 1-hydroxy-2,2-dimethylpropane-1-sulfonate |
| SMILES | CC(C)(C)C(O)S(=O)(=O)[O-] |
| InChI | InChI=1S/C5H12O4S/c1-5(2,3)4(6)10(7,8)9/h4,6H,1-3H3,(H,7,8,9)/p-1 |
| InChIKey | ORIIVMJFMLLZLL-UHFFFAOYSA-M |
| XLogP | -0.10 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|