C10H21O5S- — CID 2027692
(1S,3R)-1,7-dihydroxy-3,7-dimethyloctane-1-sulfonate (PubChem CID 2027692) has the molecular formula C10H21O5S- and a molecular weight of 253.34 g/mol. Its IUPAC name is (1S,3R)-1,7-dihydroxy-3,7-dimethyloctane-1-sulfonate.
| Compound Name | (1S,3R)-1,7-dihydroxy-3,7-dimethyloctane-1-sulfonate |
|---|---|
| PubChem CID | 2027692 |
| Molecular Formula | C10H21O5S- |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (1S,3R)-1,7-dihydroxy-3,7-dimethyloctane-1-sulfonate |
| SMILES | C[C@H](CCCC(C)(C)O)C[C@@H](O)S(=O)(=O)[O-] |
| InChI | InChI=1S/C10H22O5S/c1-8(5-4-6-10(2,3)12)7-9(11)16(13,14)15/h8-9,11-12H,4-7H2,1-3H3,(H,13,14,15)/p-1/t8-,9+/m1/s1 |
| InChIKey | OFDAQGYTOTXHPR-BDAKNGLRSA-M |
| XLogP | 0.82 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|