C19H40O9S2 — CID 163153407
[2-(4-hydroxy-4-methylpentyl)-6,10-dimethyl-11-sulfooxyundecyl] hydrogen sulfate (PubChem CID 163153407) has the molecular formula C19H40O9S2 and a molecular weight of 476.65 g/mol. Its IUPAC name is [2-(4-hydroxy-4-methylpentyl)-6,10-dimethyl-11-sulfooxyundecyl] hydrogen sulfate.
| Compound Name | [2-(4-hydroxy-4-methylpentyl)-6,10-dimethyl-11-sulfooxyundecyl] hydrogen sulfate |
|---|---|
| PubChem CID | 163153407 |
| Molecular Formula | C19H40O9S2 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | [2-(4-hydroxy-4-methylpentyl)-6,10-dimethyl-11-sulfooxyundecyl] hydrogen sulfate |
| SMILES | CC(CCCC(C)COS(=O)(=O)O)CCCC(CCCC(C)(C)O)COS(=O)(=O)O |
| InChI | InChI=1S/C19H40O9S2/c1-16(8-5-10-17(2)14-27-29(21,22)23)9-6-11-18(15-28-30(24,25)26)12-7-13-19(3,4)20/h16-18,20H,5-15H2,1-4H3,(H,21,22,23)(H,24,25,26) |
| InChIKey | OFBAAMLXOJOUSW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|