About 2-heptyldecyl hydrogen sulfate
2-heptyldecyl hydrogen sulfate (PubChem CID 101287305) has the molecular formula C17H36O4S
and a molecular weight of 336.54 g/mol. Its IUPAC name is 2-heptyldecyl hydrogen sulfate.
Molecular Properties
| Compound Name | 2-heptyldecyl hydrogen sulfate |
| PubChem CID | 101287305 |
| Molecular Formula | C17H36O4S |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 2-heptyldecyl hydrogen sulfate |
| SMILES | CCCCCCCCC(CCCCCCC)COS(=O)(=O)O |
| InChI | InChI=1S/C17H36O4S/c1-3-5-7-9-11-13-15-17(16-21-22(18,19)20)14-12-10-8-6-4-2/h17H,3-16H2,1-2H3,(H,18,19,20) |
| InChIKey | JVGRAPAKOMQHKL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-heptyldecyl hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptyldecyl hydrogen sulfate?
The IUPAC name of 2-heptyldecyl hydrogen sulfate (CID 101287305) is 2-heptyldecyl hydrogen sulfate.
What is the SMILES notation for 2-heptyldecyl hydrogen sulfate?
The canonical SMILES for 2-heptyldecyl hydrogen sulfate is CCCCCCCCC(CCCCCCC)COS(=O)(=O)O.
What is the InChIKey of 2-heptyldecyl hydrogen sulfate?
The InChIKey is JVGRAPAKOMQHKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O4S/c1-3-5-7-9-11-13-15-17(16-21-22(18,19)20)14-12-10-8-6-4-2/h17H,3-16H2,1-2H3,(H,18,19,20).
What are the key properties of 2-heptyldecyl hydrogen sulfate?
2-heptyldecyl hydrogen sulfate has a molecular weight of 336.54 g/mol, XLogP of 5.53, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptyldecyl hydrogen sulfate is sourced from PubChem (CID 101287305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).