About 2-butyldecyl 2-sulfooxyacetate
2-butyldecyl 2-sulfooxyacetate (PubChem CID 18954978) has the molecular formula C16H32O6S
and a molecular weight of 352.49 g/mol. Its IUPAC name is 2-butyldecyl 2-sulfooxyacetate.
Molecular Properties
| Compound Name | 2-butyldecyl 2-sulfooxyacetate |
| PubChem CID | 18954978 |
| Molecular Formula | C16H32O6S |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-butyldecyl 2-sulfooxyacetate |
| SMILES | CCCCCCCCC(CCCC)COC(=O)COS(=O)(=O)O |
| InChI | InChI=1S/C16H32O6S/c1-3-5-7-8-9-10-12-15(11-6-4-2)13-21-16(17)14-22-23(18,19)20/h15H,3-14H2,1-2H3,(H,18,19,20) |
| InChIKey | XRKKESNNEPWGJM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-butyldecyl 2-sulfooxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyldecyl 2-sulfooxyacetate?
The IUPAC name of 2-butyldecyl 2-sulfooxyacetate (CID 18954978) is 2-butyldecyl 2-sulfooxyacetate.
What is the SMILES notation for 2-butyldecyl 2-sulfooxyacetate?
The canonical SMILES for 2-butyldecyl 2-sulfooxyacetate is CCCCCCCCC(CCCC)COC(=O)COS(=O)(=O)O.
What is the InChIKey of 2-butyldecyl 2-sulfooxyacetate?
The InChIKey is XRKKESNNEPWGJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O6S/c1-3-5-7-8-9-10-12-15(11-6-4-2)13-21-16(17)14-22-23(18,19)20/h15H,3-14H2,1-2H3,(H,18,19,20).
What are the key properties of 2-butyldecyl 2-sulfooxyacetate?
2-butyldecyl 2-sulfooxyacetate has a molecular weight of 352.49 g/mol, XLogP of 3.91, 15 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyldecyl 2-sulfooxyacetate is sourced from PubChem (CID 18954978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).