C4H8O8S2-2 — CID 7168203
(1R,4S)-1,4-dihydroxybutane-1,4-disulfonate (PubChem CID 7168203) has the molecular formula C4H8O8S2-2 and a molecular weight of 248.23 g/mol. Its IUPAC name is (1R,4S)-1,4-dihydroxybutane-1,4-disulfonate.
| Compound Name | (1R,4S)-1,4-dihydroxybutane-1,4-disulfonate |
|---|---|
| PubChem CID | 7168203 |
| Molecular Formula | C4H8O8S2-2 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | (1R,4S)-1,4-dihydroxybutane-1,4-disulfonate |
| SMILES | O=S(=O)([O-])[C@H](O)CC[C@H](O)S(=O)(=O)[O-] |
| InChI | InChI=1S/C4H10O8S2/c5-3(13(7,8)9)1-2-4(6)14(10,11)12/h3-6H,1-2H2,(H,7,8,9)(H,10,11,12)/p-2/t3-,4+ |
| InChIKey | SBHPIPPMYYFSHJ-ZXZARUISSA-L |
| XLogP | -2.51 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|