C10H21NO2 — CID 98575417
(6R,8Z)-8-hydroxyimino-2,6-dimethyloctan-2-ol (PubChem CID 98575417) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is (6R,8Z)-8-hydroxyimino-2,6-dimethyloctan-2-ol.
| Compound Name | (6R,8Z)-8-hydroxyimino-2,6-dimethyloctan-2-ol |
|---|---|
| PubChem CID | 98575417 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | (6R,8Z)-8-hydroxyimino-2,6-dimethyloctan-2-ol |
| SMILES | C[C@@H](C/C=N\O)CCCC(C)(C)O |
| InChI | InChI=1S/C10H21NO2/c1-9(6-8-11-13)5-4-7-10(2,3)12/h8-9,12-13H,4-7H2,1-3H3/b11-8-/t9-/m1/s1 |
| InChIKey | IFWXPWFBBKIGIM-LZUGORFDSA-N |
| XLogP | 2.41 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|