C23H37NO2 — CID 158492050
3-(4-ethylphenyl)-2,2-dimethylpropanenitrile;7-hydroxy-3,7-dimethyloctanal (PubChem CID 158492050) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-2,2-dimethylpropanenitrile;7-hydroxy-3,7-dimethyloctanal.
| Compound Name | 3-(4-ethylphenyl)-2,2-dimethylpropanenitrile;7-hydroxy-3,7-dimethyloctanal |
|---|---|
| PubChem CID | 158492050 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | 3-(4-ethylphenyl)-2,2-dimethylpropanenitrile;7-hydroxy-3,7-dimethyloctanal |
| SMILES | CC(CC=O)CCCC(C)(C)O.CCc1ccc(CC(C)(C)C#N)cc1 |
| InChI | InChI=1S/C13H17N.C10H20O2/c1-4-11-5-7-12(8-6-11)9-13(2,3)10-14;1-9(6-8-11)5-4-7-10(2,3)12/h5-8H,4,9H2,1-3H3;8-9,12H,4-7H2,1-3H3 |
| InChIKey | HIUWYMMNHMHWNQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|