C13H27NO2 — CID 170783226
7-hydroxy-3,7-dimethyl-N-propan-2-yloctan-1-imine oxide (PubChem CID 170783226) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 7-hydroxy-3,7-dimethyl-N-propan-2-yloctan-1-imine oxide.
| Compound Name | 7-hydroxy-3,7-dimethyl-N-propan-2-yloctan-1-imine oxide |
|---|---|
| PubChem CID | 170783226 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 7-hydroxy-3,7-dimethyl-N-propan-2-yloctan-1-imine oxide |
| SMILES | CC(C/C=[N+](\[O-])C(C)C)CCCC(C)(C)O |
| InChI | InChI=1S/C13H27NO2/c1-11(2)14(16)10-8-12(3)7-6-9-13(4,5)15/h10-12,15H,6-9H2,1-5H3/b14-10- |
| InChIKey | QMBMIPSZZRAKOZ-UVTDQMKNSA-N |
| XLogP | 2.94 |
| TPSA | 46.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|