C20H40O3 — CID 78200754
3-(hydroxymethyl)-7,11,15-trimethylhexadec-2-ene-1,15-diol (PubChem CID 78200754) has the molecular formula C20H40O3 and a molecular weight of 328.54 g/mol. Its IUPAC name is 3-(hydroxymethyl)-7,11,15-trimethylhexadec-2-ene-1,15-diol.
| Compound Name | 3-(hydroxymethyl)-7,11,15-trimethylhexadec-2-ene-1,15-diol |
|---|---|
| PubChem CID | 78200754 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | 3-(hydroxymethyl)-7,11,15-trimethylhexadec-2-ene-1,15-diol |
| SMILES | CC(CCCC(=CCO)CO)CCCC(C)CCCC(C)(C)O |
| InChI | InChI=1S/C20H40O3/c1-17(10-6-12-19(16-22)13-15-21)8-5-9-18(2)11-7-14-20(3,4)23/h13,17-18,21-23H,5-12,14-16H2,1-4H3 |
| InChIKey | AKXRSPSASWQOHJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|