C12H28ClNO2 — CID 170893103
2-amino-5,9-dimethyldecane-1,9-diol;hydrochloride (PubChem CID 170893103) has the molecular formula C12H28ClNO2 and a molecular weight of 253.81 g/mol. Its IUPAC name is 2-amino-5,9-dimethyldecane-1,9-diol;hydrochloride.
| Compound Name | 2-amino-5,9-dimethyldecane-1,9-diol;hydrochloride |
|---|---|
| PubChem CID | 170893103 |
| Molecular Formula | C12H28ClNO2 |
| Molecular Weight | 253.81 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-amino-5,9-dimethyldecane-1,9-diol;hydrochloride |
| SMILES | CC(CCCC(C)(C)O)CCC(N)CO.Cl |
| InChI | InChI=1S/C12H27NO2.ClH/c1-10(6-7-11(13)9-14)5-4-8-12(2,3)15;/h10-11,14-15H,4-9,13H2,1-3H3;1H |
| InChIKey | PCFUSRMVXDLJNB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.81 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |