About 2,6-dimethyl-9-nitrodecane-2,8-diol
2,6-dimethyl-9-nitrodecane-2,8-diol (PubChem CID 11770747) has the molecular formula C12H25NO4
and a molecular weight of 247.33 g/mol. Its IUPAC name is 2,6-dimethyl-9-nitrodecane-2,8-diol.
Molecular Properties
| Compound Name | 2,6-dimethyl-9-nitrodecane-2,8-diol |
| PubChem CID | 11770747 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 2,6-dimethyl-9-nitrodecane-2,8-diol |
| SMILES | CC(CCCC(C)(C)O)CC(O)C(C)[N+](=O)[O-] |
| InChI | InChI=1S/C12H25NO4/c1-9(6-5-7-12(3,4)15)8-11(14)10(2)13(16)17/h9-11,14-15H,5-8H2,1-4H3 |
| InChIKey | XERGRRAHAJSUTB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-9-nitrodecane-2,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-9-nitrodecane-2,8-diol?
The IUPAC name of 2,6-dimethyl-9-nitrodecane-2,8-diol (CID 11770747) is 2,6-dimethyl-9-nitrodecane-2,8-diol.
What is the SMILES notation for 2,6-dimethyl-9-nitrodecane-2,8-diol?
The canonical SMILES for 2,6-dimethyl-9-nitrodecane-2,8-diol is CC(CCCC(C)(C)O)CC(O)C(C)[N+](=O)[O-].
What is the InChIKey of 2,6-dimethyl-9-nitrodecane-2,8-diol?
The InChIKey is XERGRRAHAJSUTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO4/c1-9(6-5-7-12(3,4)15)8-11(14)10(2)13(16)17/h9-11,14-15H,5-8H2,1-4H3.
What are the key properties of 2,6-dimethyl-9-nitrodecane-2,8-diol?
2,6-dimethyl-9-nitrodecane-2,8-diol has a molecular weight of 247.33 g/mol, XLogP of 1.98, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-9-nitrodecane-2,8-diol is sourced from PubChem (CID 11770747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).