C12H25NO4 — CID 11770747
2,6-dimethyl-9-nitrodecane-2,8-diol (PubChem CID 11770747) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is 2,6-dimethyl-9-nitrodecane-2,8-diol.
| Compound Name | 2,6-dimethyl-9-nitrodecane-2,8-diol |
|---|---|
| PubChem CID | 11770747 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 2,6-dimethyl-9-nitrodecane-2,8-diol |
| SMILES | CC(CCCC(C)(C)O)CC(O)C(C)[N+](=O)[O-] |
| InChI | InChI=1S/C12H25NO4/c1-9(6-5-7-12(3,4)15)8-11(14)10(2)13(16)17/h9-11,14-15H,5-8H2,1-4H3 |
| InChIKey | XERGRRAHAJSUTB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|