About nickel(2+);bis(propane-2-sulfonate)
nickel(2+);bis(propane-2-sulfonate) (PubChem CID 18692784) has the molecular formula C6H14NiO6S2
and a molecular weight of 305.00 g/mol. Its IUPAC name is nickel(2+);bis(propane-2-sulfonate).
Molecular Properties
| Compound Name | nickel(2+);bis(propane-2-sulfonate) |
| PubChem CID | 18692784 |
| Molecular Formula | C6H14NiO6S2 |
| Molecular Weight | 305.00 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | nickel(2+);bis(propane-2-sulfonate) |
| SMILES | CC(C)S(=O)(=O)[O-].CC(C)S(=O)(=O)[O-].[Ni+2] |
| InChI | InChI=1S/2C3H8O3S.Ni/c2*1-3(2)7(4,5)6;/h2*3H,1-2H3,(H,4,5,6);/q;;+2/p-2 |
| InChIKey | DEBMQXHCOBVMDF-UHFFFAOYSA-L |
| XLogP | -0.12 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.00 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze nickel(2+);bis(propane-2-sulfonate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel(2+);bis(propane-2-sulfonate)?
The IUPAC name of nickel(2+);bis(propane-2-sulfonate) (CID 18692784) is nickel(2+);bis(propane-2-sulfonate).
What is the SMILES notation for nickel(2+);bis(propane-2-sulfonate)?
The canonical SMILES for nickel(2+);bis(propane-2-sulfonate) is CC(C)S(=O)(=O)[O-].CC(C)S(=O)(=O)[O-].[Ni+2].
What is the InChIKey of nickel(2+);bis(propane-2-sulfonate)?
The InChIKey is DEBMQXHCOBVMDF-UHFFFAOYSA-L. The full InChI is InChI=1S/2C3H8O3S.Ni/c2*1-3(2)7(4,5)6;/h2*3H,1-2H3,(H,4,5,6);/q;;+2/p-2.
What are the key properties of nickel(2+);bis(propane-2-sulfonate)?
nickel(2+);bis(propane-2-sulfonate) has a molecular weight of 305.00 g/mol, XLogP of -0.12, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for nickel(2+);bis(propane-2-sulfonate) is sourced from PubChem (CID 18692784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).