About sodium;1-aminoethanesulfonate;ethene
sodium;1-aminoethanesulfonate;ethene (PubChem CID 162261200) has the molecular formula C4H10NNaO3S
and a molecular weight of 175.18 g/mol. Its IUPAC name is sodium;1-aminoethanesulfonate;ethene.
Molecular Properties
| Compound Name | sodium;1-aminoethanesulfonate;ethene |
| PubChem CID | 162261200 |
| Molecular Formula | C4H10NNaO3S |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | sodium;1-aminoethanesulfonate;ethene |
| SMILES | C=C.CC(N)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C2H7NO3S.C2H4.Na/c1-2(3)7(4,5)6;1-2;/h2H,3H2,1H3,(H,4,5,6);1-2H2;/q;;+1/p-1 |
| InChIKey | ALLGJBQDVDSDGL-UHFFFAOYSA-M |
| XLogP | -3.36 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;1-aminoethanesulfonate;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-aminoethanesulfonate;ethene?
The IUPAC name of sodium;1-aminoethanesulfonate;ethene (CID 162261200) is sodium;1-aminoethanesulfonate;ethene.
What is the SMILES notation for sodium;1-aminoethanesulfonate;ethene?
The canonical SMILES for sodium;1-aminoethanesulfonate;ethene is C=C.CC(N)S(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium;1-aminoethanesulfonate;ethene?
The InChIKey is ALLGJBQDVDSDGL-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H7NO3S.C2H4.Na/c1-2(3)7(4,5)6;1-2;/h2H,3H2,1H3,(H,4,5,6);1-2H2;/q;;+1/p-1.
What are the key properties of sodium;1-aminoethanesulfonate;ethene?
sodium;1-aminoethanesulfonate;ethene has a molecular weight of 175.18 g/mol, XLogP of -3.36, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-aminoethanesulfonate;ethene is sourced from PubChem (CID 162261200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).