C3H6Na2O6S2 — CID 23131501
disodium;propane-1,2-disulfonate (PubChem CID 23131501) has the molecular formula C3H6Na2O6S2 and a molecular weight of 248.19 g/mol. Its IUPAC name is disodium;propane-1,2-disulfonate.
| Compound Name | disodium;propane-1,2-disulfonate |
|---|---|
| PubChem CID | 23131501 |
| Molecular Formula | C3H6Na2O6S2 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 247.94 |
| IUPAC Name | disodium;propane-1,2-disulfonate |
| SMILES | CC(CS(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C3H8O6S2.2Na/c1-3(11(7,8)9)2-10(4,5)6;;/h3H,2H2,1H3,(H,4,5,6)(H,7,8,9);;/q;2*+1/p-2 |
| InChIKey | KRAPYTMAJKGNKP-UHFFFAOYSA-L |
| XLogP | -7.53 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | -7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|