C4H8O6S4-2 — CID 22922961
2,3-bis(sulfanyl)butane-1,4-disulfonate (PubChem CID 22922961) has the molecular formula C4H8O6S4-2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2,3-bis(sulfanyl)butane-1,4-disulfonate.
| Compound Name | 2,3-bis(sulfanyl)butane-1,4-disulfonate |
|---|---|
| PubChem CID | 22922961 |
| Molecular Formula | C4H8O6S4-2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 279.92 |
| IUPAC Name | 2,3-bis(sulfanyl)butane-1,4-disulfonate |
| SMILES | O=S(=O)([O-])CC(S)C(S)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C4H10O6S4/c5-13(6,7)1-3(11)4(12)2-14(8,9)10/h3-4,11-12H,1-2H2,(H,5,6,7)(H,8,9,10)/p-2 |
| InChIKey | IZXJZVCUTQATIP-UHFFFAOYSA-L |
| XLogP | -1.33 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|