C3H9NaO4S3 — CID 175397530
sodium;3,3-bis(sulfanyl)propane-1-sulfonate;hydrate (PubChem CID 175397530) has the molecular formula C3H9NaO4S3 and a molecular weight of 228.29 g/mol. Its IUPAC name is sodium;3,3-bis(sulfanyl)propane-1-sulfonate;hydrate.
| Compound Name | sodium;3,3-bis(sulfanyl)propane-1-sulfonate;hydrate |
|---|---|
| PubChem CID | 175397530 |
| Molecular Formula | C3H9NaO4S3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 227.96 |
| IUPAC Name | sodium;3,3-bis(sulfanyl)propane-1-sulfonate;hydrate |
| SMILES | O.O=S(=O)([O-])CCC(S)S.[Na+] |
| InChI | InChI=1S/C3H8O3S3.Na.H2O/c4-9(5,6)2-1-3(7)8;;/h3,7-8H,1-2H2,(H,4,5,6);;1H2/q;+1;/p-1 |
| InChIKey | GXOLMAAIERJBQB-UHFFFAOYSA-M |
| XLogP | -3.71 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|