C2H4O6S2Sr — CID 87366284
strontium ethane-1,2-disulfonate (PubChem CID 87366284) has the molecular formula C2H4O6S2Sr and a molecular weight of 275.80 g/mol. Its IUPAC name is strontium ethane-1,2-disulfonate.
| Compound Name | strontium ethane-1,2-disulfonate |
|---|---|
| PubChem CID | 87366284 |
| Molecular Formula | C2H4O6S2Sr |
| Molecular Weight | 275.80 g/mol |
| Exact Mass | 275.85 |
| IUPAC Name | strontium ethane-1,2-disulfonate |
| SMILES | O=S(=O)([O-])CCS(=O)(=O)[O-].[Sr+2] |
| InChI | InChI=1S/C2H6O6S2.Sr/c3-9(4,5)1-2-10(6,7)8;/h1-2H2,(H,3,4,5)(H,6,7,8);/q;+2/p-2 |
| InChIKey | WBHZIVSNCIWYNB-UHFFFAOYSA-L |
| XLogP | -2.30 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.80 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|