About 2-hydroxyethanesulfonate
2-hydroxyethanesulfonate (PubChem CID 18931617) has the molecular formula C4H10O8S2-2
and a molecular weight of 250.25 g/mol. Its IUPAC name is 2-hydroxyethanesulfonate.
Molecular Properties
| Compound Name | 2-hydroxyethanesulfonate |
| PubChem CID | 18931617 |
| Molecular Formula | C4H10O8S2-2 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | 2-hydroxyethanesulfonate |
| SMILES | O=S(=O)([O-])CCO.O=S(=O)([O-])CCO |
| InChI | InChI=1S/2C2H6O4S/c2*3-1-2-7(4,5)6/h2*3H,1-2H2,(H,4,5,6)/p-2 |
| InChIKey | QKRMFCXDTFLKKT-UHFFFAOYSA-L |
| XLogP | -2.95 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethanesulfonate?
The IUPAC name of 2-hydroxyethanesulfonate (CID 18931617) is 2-hydroxyethanesulfonate.
What is the SMILES notation for 2-hydroxyethanesulfonate?
The canonical SMILES for 2-hydroxyethanesulfonate is O=S(=O)([O-])CCO.O=S(=O)([O-])CCO.
What is the InChIKey of 2-hydroxyethanesulfonate?
The InChIKey is QKRMFCXDTFLKKT-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H6O4S/c2*3-1-2-7(4,5)6/h2*3H,1-2H2,(H,4,5,6)/p-2.
What are the key properties of 2-hydroxyethanesulfonate?
2-hydroxyethanesulfonate has a molecular weight of 250.25 g/mol, XLogP of -2.95, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethanesulfonate is sourced from PubChem (CID 18931617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).